C13H23NS — CID 142021683
4-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]sulfanylethyl]piperidine (PubChem CID 142021683) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is 4-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]sulfanylethyl]piperidine.
| Compound Name | 4-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]sulfanylethyl]piperidine |
|---|---|
| PubChem CID | 142021683 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 4-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]sulfanylethyl]piperidine |
| SMILES | C/C=C\C(=C/C)SCCC1CCNCC1 |
| InChI | InChI=1S/C13H23NS/c1-3-5-13(4-2)15-11-8-12-6-9-14-10-7-12/h3-5,12,14H,6-11H2,1-2H3/b5-3-,13-4+ |
| InChIKey | CKUQJPZNCBTFHJ-OHOMROLUSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|