C14H25NS — CID 166104304
3-(cyclohexa-1,5-dien-1-ylsulfanylmethyl)piperidine;ethane (PubChem CID 166104304) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is 3-(cyclohexa-1,5-dien-1-ylsulfanylmethyl)piperidine;ethane.
| Compound Name | 3-(cyclohexa-1,5-dien-1-ylsulfanylmethyl)piperidine;ethane |
|---|---|
| PubChem CID | 166104304 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-(cyclohexa-1,5-dien-1-ylsulfanylmethyl)piperidine;ethane |
| SMILES | C1=CC(SCC2CCCNC2)=CCC1.CC |
| InChI | InChI=1S/C12H19NS.C2H6/c1-2-6-12(7-3-1)14-10-11-5-4-8-13-9-11;1-2/h2,6-7,11,13H,1,3-5,8-10H2;1-2H3 |
| InChIKey | DELVDQZYPZPWCN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |