C36H48N4OS — CID 142022873
N-[5-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]pentyl]-9-ethylcarbazole-3-carboxamide;ethane (PubChem CID 142022873) has the molecular formula C36H48N4OS and a molecular weight of 584.87 g/mol. Its IUPAC name is N-[5-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]pentyl]-9-ethylcarbazole-3-carboxamide;ethane.
| Compound Name | N-[5-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]pentyl]-9-ethylcarbazole-3-carboxamide;ethane |
|---|---|
| PubChem CID | 142022873 |
| Molecular Formula | C36H48N4OS |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | N-[5-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]pentyl]-9-ethylcarbazole-3-carboxamide;ethane |
| SMILES | CC.CC.CCn1c2ccccc2c2cc(C(=O)NCCCCCNSc3cccc4c(N(C)C)cccc34)ccc21 |
| InChI | InChI=1S/C32H36N4OS.2C2H6/c1-4-36-29-15-7-6-12-25(29)27-22-23(18-19-30(27)36)32(37)33-20-8-5-9-21-34-38-31-17-11-13-24-26(31)14-10-16-28(24)35(2)3;2*1-2/h6-7,10-19,22,34H,4-5,8-9,20-21H2,1-3H3,(H,33,37);2*1-2H3 |
| InChIKey | NYPSOERKTYZNQX-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|