C28H34N2OS — CID 142022917
N-[5-[(2,3-dimethylphenyl)sulfanylamino]pentyl]-4-methyl-3-(2-methylphenyl)benzamide (PubChem CID 142022917) has the molecular formula C28H34N2OS and a molecular weight of 446.66 g/mol. Its IUPAC name is N-[5-[(2,3-dimethylphenyl)sulfanylamino]pentyl]-4-methyl-3-(2-methylphenyl)benzamide.
| Compound Name | N-[5-[(2,3-dimethylphenyl)sulfanylamino]pentyl]-4-methyl-3-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 142022917 |
| Molecular Formula | C28H34N2OS |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[5-[(2,3-dimethylphenyl)sulfanylamino]pentyl]-4-methyl-3-(2-methylphenyl)benzamide |
| SMILES | Cc1ccccc1-c1cc(C(=O)NCCCCCNSc2cccc(C)c2C)ccc1C |
| InChI | InChI=1S/C28H34N2OS/c1-20-12-10-14-27(23(20)4)32-30-18-9-5-8-17-29-28(31)24-16-15-22(3)26(19-24)25-13-7-6-11-21(25)2/h6-7,10-16,19,30H,5,8-9,17-18H2,1-4H3,(H,29,31) |
| InChIKey | LGKDDLGXFYLIKG-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|