About 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one
1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one (PubChem CID 142023760) has the molecular formula C19H23FN2O
and a molecular weight of 314.40 g/mol. Its IUPAC name is 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one.
Molecular Properties
| Compound Name | 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one |
| PubChem CID | 142023760 |
| Molecular Formula | C19H23FN2O |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one |
| SMILES | CC(=O)/C(=N\N)c1cc(F)ccc1C.CCc1cccc(C)c1 |
| InChI | InChI=1S/C10H11FN2O.C9H12/c1-6-3-4-8(11)5-9(6)10(13-12)7(2)14;1-3-9-6-4-5-8(2)7-9/h3-5H,12H2,1-2H3;4-7H,3H2,1-2H3/b13-10+; |
| InChIKey | OXRMTTGBPGDQRT-RSGUCCNWSA-N |
| XLogP | 3.94 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one?
The IUPAC name of 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one (CID 142023760) is 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one.
What is the SMILES notation for 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one?
The canonical SMILES for 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one is CC(=O)/C(=N\N)c1cc(F)ccc1C.CCc1cccc(C)c1.
What is the InChIKey of 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one?
The InChIKey is OXRMTTGBPGDQRT-RSGUCCNWSA-N. The full InChI is InChI=1S/C10H11FN2O.C9H12/c1-6-3-4-8(11)5-9(6)10(13-12)7(2)14;1-3-9-6-4-5-8(2)7-9/h3-5H,12H2,1-2H3;4-7H,3H2,1-2H3/b13-10+;.
What are the key properties of 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one?
1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one has a molecular weight of 314.40 g/mol, XLogP of 3.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methylbenzene;(1Z)-1-(5-fluoro-2-methylphenyl)-1-hydrazinylidenepropan-2-one is sourced from PubChem (CID 142023760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).