C8H8N4S — CID 142026886
N'-methyl-2,1,3-benzothiadiazole-5-carboximidamide (PubChem CID 142026886) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is N'-methyl-2,1,3-benzothiadiazole-5-carboximidamide.
| Compound Name | N'-methyl-2,1,3-benzothiadiazole-5-carboximidamide |
|---|---|
| PubChem CID | 142026886 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | N'-methyl-2,1,3-benzothiadiazole-5-carboximidamide |
| SMILES | C/N=C(\N)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C8H8N4S/c1-10-8(9)5-2-3-6-7(4-5)12-13-11-6/h2-4H,1H3,(H2,9,10) |
| InChIKey | XNPCVPZPIKMTHD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|