C10H19NO2S — CID 142029980
N,2-dimethylcyclohexa-1,5-diene-1-sulfonamide;ethane (PubChem CID 142029980) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is N,2-dimethylcyclohexa-1,5-diene-1-sulfonamide;ethane.
| Compound Name | N,2-dimethylcyclohexa-1,5-diene-1-sulfonamide;ethane |
|---|---|
| PubChem CID | 142029980 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N,2-dimethylcyclohexa-1,5-diene-1-sulfonamide;ethane |
| SMILES | CC.CNS(=O)(=O)C1=C(C)CCC=C1 |
| InChI | InChI=1S/C8H13NO2S.C2H6/c1-7-5-3-4-6-8(7)12(10,11)9-2;1-2/h4,6,9H,3,5H2,1-2H3;1-2H3 |
| InChIKey | YXMVJCATHUDVCW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |