C21H35NO6 — CID 142031596
[(2R,3S,5R,9S,11R)-2-ethyl-3,5,9,11,13-pentamethyl-6,12,14-trioxo-oxacyclotetradec-3-yl] carbamate (PubChem CID 142031596) has the molecular formula C21H35NO6 and a molecular weight of 397.51 g/mol. Its IUPAC name is [(2R,3S,5R,9S,11R)-2-ethyl-3,5,9,11,13-pentamethyl-6,12,14-trioxo-oxacyclotetradec-3-yl] carbamate.
| Compound Name | [(2R,3S,5R,9S,11R)-2-ethyl-3,5,9,11,13-pentamethyl-6,12,14-trioxo-oxacyclotetradec-3-yl] carbamate |
|---|---|
| PubChem CID | 142031596 |
| Molecular Formula | C21H35NO6 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | [(2R,3S,5R,9S,11R)-2-ethyl-3,5,9,11,13-pentamethyl-6,12,14-trioxo-oxacyclotetradec-3-yl] carbamate |
| SMILES | CC[C@H]1OC(=O)C(C)C(=O)[C@H](C)C[C@@H](C)CCC(=O)[C@H](C)C[C@]1(C)OC(N)=O |
| InChI | InChI=1S/C21H35NO6/c1-7-17-21(6,28-20(22)26)11-14(4)16(23)9-8-12(2)10-13(3)18(24)15(5)19(25)27-17/h12-15,17H,7-11H2,1-6H3,(H2,22,26)/t12-,13+,14+,15?,17+,21-/m0/s1 |
| InChIKey | LKYVBTCTEVSYEA-BYEADVMBSA-N |
| XLogP | 3.42 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|