C18H34N4O2S — CID 142033561
N-[1-[[3-[dimethylsulfinamoyl(methyl)amino]cyclopentyl]methyl]piperidin-4-yl]-N-prop-2-enylformamide (PubChem CID 142033561) has the molecular formula C18H34N4O2S and a molecular weight of 370.56 g/mol. Its IUPAC name is N-[1-[[3-[dimethylsulfinamoyl(methyl)amino]cyclopentyl]methyl]piperidin-4-yl]-N-prop-2-enylformamide.
| Compound Name | N-[1-[[3-[dimethylsulfinamoyl(methyl)amino]cyclopentyl]methyl]piperidin-4-yl]-N-prop-2-enylformamide |
|---|---|
| PubChem CID | 142033561 |
| Molecular Formula | C18H34N4O2S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-[1-[[3-[dimethylsulfinamoyl(methyl)amino]cyclopentyl]methyl]piperidin-4-yl]-N-prop-2-enylformamide |
| SMILES | C=CCN(C=O)C1CCN(CC2CCC(N(C)S(=O)N(C)C)C2)CC1 |
| InChI | InChI=1S/C18H34N4O2S/c1-5-10-22(15-23)17-8-11-21(12-9-17)14-16-6-7-18(13-16)20(4)25(24)19(2)3/h5,15-18H,1,6-14H2,2-4H3 |
| InChIKey | GZWOQIZRHRLJTQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|