C34H32N2OP2 — CID 142035963
N-[2-[2-[amino(methyl)phosphanyl]-6-methylphenyl]-3-methylphenyl]-2-diphenylphosphanylbenzamide (PubChem CID 142035963) has the molecular formula C34H32N2OP2 and a molecular weight of 546.59 g/mol. Its IUPAC name is N-[2-[2-[amino(methyl)phosphanyl]-6-methylphenyl]-3-methylphenyl]-2-diphenylphosphanylbenzamide.
| Compound Name | N-[2-[2-[amino(methyl)phosphanyl]-6-methylphenyl]-3-methylphenyl]-2-diphenylphosphanylbenzamide |
|---|---|
| PubChem CID | 142035963 |
| Molecular Formula | C34H32N2OP2 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | N-[2-[2-[amino(methyl)phosphanyl]-6-methylphenyl]-3-methylphenyl]-2-diphenylphosphanylbenzamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2P(c2ccccc2)c2ccccc2)c1-c1c(C)cccc1P(C)N |
| InChI | InChI=1S/C34H32N2OP2/c1-24-14-12-21-29(32(24)33-25(2)15-13-23-31(33)38(3)35)36-34(37)28-20-10-11-22-30(28)39(26-16-6-4-7-17-26)27-18-8-5-9-19-27/h4-23H,35H2,1-3H3,(H,36,37) |
| InChIKey | WLMGHPWTOKWCLV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|