About bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane
bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane (PubChem CID 90341440) has the molecular formula C42H36O3P2
and a molecular weight of 650.70 g/mol. Its IUPAC name is bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane.
Molecular Properties
| Compound Name | bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane |
| PubChem CID | 90341440 |
| Molecular Formula | C42H36O3P2 |
| Molecular Weight | 650.70 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane |
| SMILES | Cc1ccccc1C(=O)P(C(=O)c1ccccc1C)C(=O)c1ccccc1C.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21O3P.C18H15P/c1-16-10-4-7-13-19(16)22(25)28(23(26)20-14-8-5-11-17(20)2)24(27)21-15-9-6-12-18(21)3;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h4-15H,1-3H3;1-15H |
| InChIKey | MPUQPWNSIQWVOG-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 650.70 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane?
The IUPAC name of bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane (CID 90341440) is bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane.
What is the SMILES notation for bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane?
The canonical SMILES for bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane is Cc1ccccc1C(=O)P(C(=O)c1ccccc1C)C(=O)c1ccccc1C.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane?
The InChIKey is MPUQPWNSIQWVOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21O3P.C18H15P/c1-16-10-4-7-13-19(16)22(25)28(23(26)20-14-8-5-11-17(20)2)24(27)21-15-9-6-12-18(21)3;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h4-15H,1-3H3;1-15H.
What are the key properties of bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane?
bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane has a molecular weight of 650.70 g/mol, XLogP of 9.36, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylbenzoyl)phosphanyl-(2-methylphenyl)methanone;triphenylphosphane is sourced from PubChem (CID 90341440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).