C25H35N7O5 — CID 142039090
3-[[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]-1-hydroxybutyl]amino]-4-oxo-5-(1-phenylethylamino)pentanoic acid (PubChem CID 142039090) has the molecular formula C25H35N7O5 and a molecular weight of 513.60 g/mol. Its IUPAC name is 3-[[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]-1-hydroxybutyl]amino]-4-oxo-5-(1-phenylethylamino)pentanoic acid.
| Compound Name | 3-[[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]-1-hydroxybutyl]amino]-4-oxo-5-(1-phenylethylamino)pentanoic acid |
|---|---|
| PubChem CID | 142039090 |
| Molecular Formula | C25H35N7O5 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 3-[[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]-1-hydroxybutyl]amino]-4-oxo-5-(1-phenylethylamino)pentanoic acid |
| SMILES | [H]/N=C(CNc1nccn(C(CC)C(O)NC(CC(=O)O)C(=O)CNC(C)c2ccccc2)c1=O)\C(C)=N\[H] |
| InChI | InChI=1S/C25H35N7O5/c1-4-20(32-11-10-28-23(25(32)37)30-13-18(27)15(2)26)24(36)31-19(12-22(34)35)21(33)14-29-16(3)17-8-6-5-7-9-17/h5-11,16,19-20,24,26-27,29,31,36H,4,12-14H2,1-3H3,(H,28,30)(H,34,35)/b26-15+,27-18- |
| InChIKey | PHWUSIGMPKYRON-CIUWNPIFSA-N |
| XLogP | 1.34 |
| TPSA | 193.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|