C25H38N8O6 — CID 142039121
5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-[2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxopyrazin-1-yl]butanoylamino]-4-oxopentanoic acid (PubChem CID 142039121) has the molecular formula C25H38N8O6 and a molecular weight of 546.63 g/mol. Its IUPAC name is 5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-[2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxopyrazin-1-yl]butanoylamino]-4-oxopentanoic acid.
| Compound Name | 5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-[2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxopyrazin-1-yl]butanoylamino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 142039121 |
| Molecular Formula | C25H38N8O6 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-[2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxopyrazin-1-yl]butanoylamino]-4-oxopentanoic acid |
| SMILES | [H]/N=C(C)/C(CNc1nccn(C(CC)C(=O)NC(CC(=O)O)C(=O)CN2CCN3CCCCC3C2)c1=O)=N\O |
| InChI | InChI=1S/C25H38N8O6/c1-3-20(33-9-7-27-23(25(33)38)28-13-19(30-39)16(2)26)24(37)29-18(12-22(35)36)21(34)15-31-10-11-32-8-5-4-6-17(32)14-31/h7,9,17-18,20,26,39H,3-6,8,10-15H2,1-2H3,(H,27,28)(H,29,37)(H,35,36)/b26-16+,30-19- |
| InChIKey | YUNJINRHKGPUGW-HPMLNYIOSA-N |
| XLogP | 0.17 |
| TPSA | 193.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|