C23H36FN7O6 — CID 142039006
5-[5-fluoropentyl(methyl)amino]-3-[2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxopyrazin-1-yl]butanoylamino]-4-oxopentanoic acid (PubChem CID 142039006) has the molecular formula C23H36FN7O6 and a molecular weight of 525.58 g/mol. Its IUPAC name is 5-[5-fluoropentyl(methyl)amino]-3-[2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxopyrazin-1-yl]butanoylamino]-4-oxopentanoic acid.
| Compound Name | 5-[5-fluoropentyl(methyl)amino]-3-[2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxopyrazin-1-yl]butanoylamino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 142039006 |
| Molecular Formula | C23H36FN7O6 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 5-[5-fluoropentyl(methyl)amino]-3-[2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxopyrazin-1-yl]butanoylamino]-4-oxopentanoic acid |
| SMILES | [H]/N=C(C)/C(CNc1nccn(C(CC)C(=O)NC(CC(=O)O)C(=O)CN(C)CCCCCF)c1=O)=N\O |
| InChI | InChI=1S/C23H36FN7O6/c1-4-18(31-11-9-26-21(23(31)36)27-13-17(29-37)15(2)25)22(35)28-16(12-20(33)34)19(32)14-30(3)10-7-5-6-8-24/h9,11,16,18,25,37H,4-8,10,12-14H2,1-3H3,(H,26,27)(H,28,35)(H,33,34)/b25-15+,29-17- |
| InChIKey | IDQSORADWVXPMA-WIIAHXAESA-N |
| XLogP | 1.08 |
| TPSA | 190.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|