C23H35N7O5 — CID 88938495
3-[2-[3-(2,3-diiminobutylamino)-5-ethyl-2-oxopyrazin-1-yl]butanoylamino]-4-oxo-5-pyrrolidin-1-ylpentanoic acid (PubChem CID 88938495) has the molecular formula C23H35N7O5 and a molecular weight of 489.58 g/mol. Its IUPAC name is 3-[2-[3-(2,3-diiminobutylamino)-5-ethyl-2-oxopyrazin-1-yl]butanoylamino]-4-oxo-5-pyrrolidin-1-ylpentanoic acid.
| Compound Name | 3-[2-[3-(2,3-diiminobutylamino)-5-ethyl-2-oxopyrazin-1-yl]butanoylamino]-4-oxo-5-pyrrolidin-1-ylpentanoic acid |
|---|---|
| PubChem CID | 88938495 |
| Molecular Formula | C23H35N7O5 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 3-[2-[3-(2,3-diiminobutylamino)-5-ethyl-2-oxopyrazin-1-yl]butanoylamino]-4-oxo-5-pyrrolidin-1-ylpentanoic acid |
| SMILES | [H]/N=C(CNc1nc(CC)cn(C(CC)C(=O)NC(CC(=O)O)C(=O)CN2CCCC2)c1=O)\C(C)=N\[H] |
| InChI | InChI=1S/C23H35N7O5/c1-4-15-12-30(23(35)21(27-15)26-11-16(25)14(3)24)18(5-2)22(34)28-17(10-20(32)33)19(31)13-29-8-6-7-9-29/h12,17-18,24-25H,4-11,13H2,1-3H3,(H,26,27)(H,28,34)(H,32,33)/b24-14+,25-16- |
| InChIKey | BJYVSIVIPDLXAH-OMRLFUBUSA-N |
| XLogP | 0.85 |
| TPSA | 181.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|