C35H46N4O4S — CID 142042685
2-amino-6-(benzenesulfonamido)-N-[6-hydroxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;buta-1,3-diene;prop-1-ene (PubChem CID 142042685) has the molecular formula C35H46N4O4S and a molecular weight of 618.84 g/mol. Its IUPAC name is 2-amino-6-(benzenesulfonamido)-N-[6-hydroxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;buta-1,3-diene;prop-1-ene.
| Compound Name | 2-amino-6-(benzenesulfonamido)-N-[6-hydroxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;buta-1,3-diene;prop-1-ene |
|---|---|
| PubChem CID | 142042685 |
| Molecular Formula | C35H46N4O4S |
| Molecular Weight | 618.84 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 2-amino-6-(benzenesulfonamido)-N-[6-hydroxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;buta-1,3-diene;prop-1-ene |
| SMILES | C=CC.C=CC=C.NC(CCCCNS(=O)(=O)c1ccccc1)C(=O)NC1CCc2cc(O)ccc2C1Cc1cccnc1 |
| InChI | InChI=1S/C28H34N4O4S.C4H6.C3H6/c29-26(10-4-5-16-31-37(35,36)23-8-2-1-3-9-23)28(34)32-27-14-11-21-18-22(33)12-13-24(21)25(27)17-20-7-6-15-30-19-20;1-3-4-2;1-3-2/h1-3,6-9,12-13,15,18-19,25-27,31,33H,4-5,10-11,14,16-17,29H2,(H,32,34);3-4H,1-2H2;3H,1H2,2H3 |
| InChIKey | ADYOADGTWKAYBM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.84 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|