C28H34N4O3S — CID 59886421
CID 59886421 (PubChem CID 59886421) has the molecular formula C28H34N4O3S and a molecular weight of 506.67 g/mol.
| Compound Name | CID 59886421 |
|---|---|
| PubChem CID | 59886421 |
| Molecular Formula | C28H34N4O3S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | — |
| SMILES | NC(CCCCNS(=O)(=O)c1ccccc1)CN[C]1CCc2cc(O)ccc2[C]1Cc1cccnc1 |
| InChI | InChI=1S/C28H34N4O3S/c29-23(8-4-5-16-32-36(34,35)25-9-2-1-3-10-25)20-31-28-14-11-22-18-24(33)12-13-26(22)27(28)17-21-7-6-15-30-19-21/h1-3,6-7,9-10,12-13,15,18-19,23,31-33H,4-5,8,11,14,16-17,20,29H2 |
| InChIKey | WJQBOJWWOLOBNY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|