C32H39N3O3S — CID 142042705
6-(benzenesulfonamido)-N-[1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;buta-1,3-diene (PubChem CID 142042705) has the molecular formula C32H39N3O3S and a molecular weight of 545.75 g/mol. Its IUPAC name is 6-(benzenesulfonamido)-N-[1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;buta-1,3-diene.
| Compound Name | 6-(benzenesulfonamido)-N-[1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;buta-1,3-diene |
|---|---|
| PubChem CID | 142042705 |
| Molecular Formula | C32H39N3O3S |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | 6-(benzenesulfonamido)-N-[1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;buta-1,3-diene |
| SMILES | C=CC=C.O=C(CCCCCNS(=O)(=O)c1ccccc1)NC1CCc2ccccc2C1Cc1cccnc1 |
| InChI | InChI=1S/C28H33N3O3S.C4H6/c32-28(15-5-2-8-19-30-35(33,34)24-12-3-1-4-13-24)31-27-17-16-23-11-6-7-14-25(23)26(27)20-22-10-9-18-29-21-22;1-3-4-2/h1,3-4,6-7,9-14,18,21,26-27,30H,2,5,8,15-17,19-20H2,(H,31,32);3-4H,1-2H2 |
| InChIKey | CIJOVYFKCINFCQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|