C38H50N2O4 — CID 142043945
formaldehyde;methoxyethane;3-[2-[[1-(4-phenylmethoxyphenyl)-3-(3-phenylpropylamino)butan-2-yl]amino]ethyl]phenol (PubChem CID 142043945) has the molecular formula C38H50N2O4 and a molecular weight of 598.83 g/mol. Its IUPAC name is formaldehyde;methoxyethane;3-[2-[[1-(4-phenylmethoxyphenyl)-3-(3-phenylpropylamino)butan-2-yl]amino]ethyl]phenol.
| Compound Name | formaldehyde;methoxyethane;3-[2-[[1-(4-phenylmethoxyphenyl)-3-(3-phenylpropylamino)butan-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 142043945 |
| Molecular Formula | C38H50N2O4 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.38 |
| IUPAC Name | formaldehyde;methoxyethane;3-[2-[[1-(4-phenylmethoxyphenyl)-3-(3-phenylpropylamino)butan-2-yl]amino]ethyl]phenol |
| SMILES | C=O.CC(NCCCc1ccccc1)C(Cc1ccc(OCc2ccccc2)cc1)NCCc1cccc(O)c1.CCOC |
| InChI | InChI=1S/C34H40N2O2.C3H8O.CH2O/c1-27(35-22-9-15-28-10-4-2-5-11-28)34(36-23-21-29-14-8-16-32(37)24-29)25-30-17-19-33(20-18-30)38-26-31-12-6-3-7-13-31;1-3-4-2;1-2/h2-8,10-14,16-20,24,27,34-37H,9,15,21-23,25-26H2,1H3;3H2,1-2H3;1H2 |
| InChIKey | PTQMPGYEAHVECK-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|