C20H19N3O4 — CID 142046963
ethane;4-oxo-4-[(4-oxo-2,3-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,5(16),6,8,10(15),11,13-heptaen-13-yl)amino]butanoic acid (PubChem CID 142046963) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is ethane;4-oxo-4-[(4-oxo-2,3-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,5(16),6,8,10(15),11,13-heptaen-13-yl)amino]butanoic acid.
| Compound Name | ethane;4-oxo-4-[(4-oxo-2,3-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,5(16),6,8,10(15),11,13-heptaen-13-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 142046963 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | ethane;4-oxo-4-[(4-oxo-2,3-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,5(16),6,8,10(15),11,13-heptaen-13-yl)amino]butanoic acid |
| SMILES | CC.O=C(O)CCC(=O)Nc1ccc2c(c1)-c1n[nH]c(=O)c3cccc-2c13 |
| InChI | InChI=1S/C18H13N3O4.C2H6/c22-14(6-7-15(23)24)19-9-4-5-10-11-2-1-3-12-16(11)17(13(10)8-9)20-21-18(12)25;1-2/h1-5,8H,6-7H2,(H,19,22)(H,21,25)(H,23,24);1-2H3 |
| InChIKey | ODJADWGGFOZNND-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |