C21H24N4O2 — CID 142047119
2-[4-[(2-methoxyethylamino)methyl]cyclohepta-1,3,5-trien-1-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 142047119) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-[4-[(2-methoxyethylamino)methyl]cyclohepta-1,3,5-trien-1-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[4-[(2-methoxyethylamino)methyl]cyclohepta-1,3,5-trien-1-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 142047119 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-[4-[(2-methoxyethylamino)methyl]cyclohepta-1,3,5-trien-1-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | COCCNCC1=CC=C(c2nc3cccc4c3n2CCNC4=O)CC=C1 |
| InChI | InChI=1S/C21H24N4O2/c1-27-13-11-22-14-15-4-2-5-16(9-8-15)20-24-18-7-3-6-17-19(18)25(20)12-10-23-21(17)26/h2-4,6-9,22H,5,10-14H2,1H3,(H,23,26) |
| InChIKey | NLTGAHKVLPGPGF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|