C13H21N5O4S — CID 142047186
(2R,5R)-5-(6-amino-1-methyl-6H-purin-9-yl)-2-(hydroxymethyl)-4-(methylsulfanylmethoxy)oxolan-3-ol (PubChem CID 142047186) has the molecular formula C13H21N5O4S and a molecular weight of 343.41 g/mol. Its IUPAC name is (2R,5R)-5-(6-amino-1-methyl-6H-purin-9-yl)-2-(hydroxymethyl)-4-(methylsulfanylmethoxy)oxolan-3-ol.
| Compound Name | (2R,5R)-5-(6-amino-1-methyl-6H-purin-9-yl)-2-(hydroxymethyl)-4-(methylsulfanylmethoxy)oxolan-3-ol |
|---|---|
| PubChem CID | 142047186 |
| Molecular Formula | C13H21N5O4S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (2R,5R)-5-(6-amino-1-methyl-6H-purin-9-yl)-2-(hydroxymethyl)-4-(methylsulfanylmethoxy)oxolan-3-ol |
| SMILES | CSCOC1C(O)[C@@H](CO)O[C@H]1n1cnc2c1N=CN(C)C2N |
| InChI | InChI=1S/C13H21N5O4S/c1-17-4-16-12-8(11(17)14)15-5-18(12)13-10(21-6-23-2)9(20)7(3-19)22-13/h4-5,7,9-11,13,19-20H,3,6,14H2,1-2H3/t7-,9?,10?,11?,13-/m1/s1 |
| InChIKey | KFNMOARQBPCWFU-GFLISSONSA-N |
| XLogP | -0.60 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|