C11H17N4O8P — CID 57295377
[(2R,5R)-3,4-dihydroxy-5-(6-hydroxy-1-methyl-6H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 57295377) has the molecular formula C11H17N4O8P and a molecular weight of 364.25 g/mol. Its IUPAC name is [(2R,5R)-3,4-dihydroxy-5-(6-hydroxy-1-methyl-6H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,5R)-3,4-dihydroxy-5-(6-hydroxy-1-methyl-6H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 57295377 |
| Molecular Formula | C11H17N4O8P |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [(2R,5R)-3,4-dihydroxy-5-(6-hydroxy-1-methyl-6H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CN1C=Nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)O)C(O)C2O)C1O |
| InChI | InChI=1S/C11H17N4O8P/c1-14-3-13-9-6(10(14)18)12-4-15(9)11-8(17)7(16)5(23-11)2-22-24(19,20)21/h3-5,7-8,10-11,16-18H,2H2,1H3,(H2,19,20,21)/t5-,7?,8?,10?,11-/m1/s1 |
| InChIKey | LFDDZSBIMNELER-WQIKJBKWSA-N |
| XLogP | -1.79 |
| TPSA | 170.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|