C13H17N2O8P — CID 46936911
[(2S,3R,4R,5R)-3,4-dihydroxy-5-(5-methoxybenzimidazol-1-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 46936911) has the molecular formula C13H17N2O8P and a molecular weight of 360.26 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-3,4-dihydroxy-5-(5-methoxybenzimidazol-1-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,3R,4R,5R)-3,4-dihydroxy-5-(5-methoxybenzimidazol-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 46936911 |
| Molecular Formula | C13H17N2O8P |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | [(2S,3R,4R,5R)-3,4-dihydroxy-5-(5-methoxybenzimidazol-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | COc1ccc2c(c1)ncn2[C@@H]1O[C@@H](COP(=O)(O)O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H17N2O8P/c1-21-7-2-3-9-8(4-7)14-6-15(9)13-12(17)11(16)10(23-13)5-22-24(18,19)20/h2-4,6,10-13,16-17H,5H2,1H3,(H2,18,19,20)/t10-,11-,12+,13+/m0/s1 |
| InChIKey | VYUPJUKSTVHSQI-WUHRBBMRSA-N |
| XLogP | -0.23 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|