C13H26O3 — CID 142047920
4,5-diethyl-1,3-dioxolane;2,3-diethyloxirane (PubChem CID 142047920) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is 4,5-diethyl-1,3-dioxolane;2,3-diethyloxirane.
| Compound Name | 4,5-diethyl-1,3-dioxolane;2,3-diethyloxirane |
|---|---|
| PubChem CID | 142047920 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 4,5-diethyl-1,3-dioxolane;2,3-diethyloxirane |
| SMILES | CCC1OC1CC.CCC1OCOC1CC |
| InChI | InChI=1S/C7H14O2.C6H12O/c1-3-6-7(4-2)9-5-8-6;1-3-5-6(4-2)7-5/h6-7H,3-5H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | ONYKARBEVGVPLH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|