About N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one
N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one (PubChem CID 142048323) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one.
Molecular Properties
| Compound Name | N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one |
| PubChem CID | 142048323 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one |
| SMILES | C=C(/C=C\C(C)=O)CCCC.CCC/C=N/C |
| InChI | InChI=1S/C10H16O.C5H11N/c1-4-5-6-9(2)7-8-10(3)11;1-3-4-5-6-2/h7-8H,2,4-6H2,1,3H3;5H,3-4H2,1-2H3/b8-7-;6-5+ |
| InChIKey | XMOMYCSLQPUDCR-UVMKXWSCSA-N |
| XLogP | 4.37 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one?
The IUPAC name of N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one (CID 142048323) is N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one.
What is the SMILES notation for N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one?
The canonical SMILES for N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one is C=C(/C=C\C(C)=O)CCCC.CCC/C=N/C.
What is the InChIKey of N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one?
The InChIKey is XMOMYCSLQPUDCR-UVMKXWSCSA-N. The full InChI is InChI=1S/C10H16O.C5H11N/c1-4-5-6-9(2)7-8-10(3)11;1-3-4-5-6-2/h7-8H,2,4-6H2,1,3H3;5H,3-4H2,1-2H3/b8-7-;6-5+.
What are the key properties of N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one?
N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one has a molecular weight of 237.39 g/mol, XLogP of 4.37, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylbutan-1-imine;(Z)-5-methylidenenon-3-en-2-one is sourced from PubChem (CID 142048323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).