C17H16FNO3 — CID 142050358
1-[3-(6-fluoro-1,2-benzoxazol-3-yl)phenoxy]butan-2-ol (PubChem CID 142050358) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is 1-[3-(6-fluoro-1,2-benzoxazol-3-yl)phenoxy]butan-2-ol.
| Compound Name | 1-[3-(6-fluoro-1,2-benzoxazol-3-yl)phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 142050358 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 1-[3-(6-fluoro-1,2-benzoxazol-3-yl)phenoxy]butan-2-ol |
| SMILES | CCC(O)COc1cccc(-c2noc3cc(F)ccc23)c1 |
| InChI | InChI=1S/C17H16FNO3/c1-2-13(20)10-21-14-5-3-4-11(8-14)17-15-7-6-12(18)9-16(15)22-19-17/h3-9,13,20H,2,10H2,1H3 |
| InChIKey | DVEXGOMEMOSJAC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |