C24H27FN2O3 — CID 58928275
(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-3-[4-(6-fluoro-1,2-benzoxazol-3-yl)phenoxy]propan-2-ol (PubChem CID 58928275) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is (2R)-1-[2-(cyclohexen-1-yl)ethylamino]-3-[4-(6-fluoro-1,2-benzoxazol-3-yl)phenoxy]propan-2-ol.
| Compound Name | (2R)-1-[2-(cyclohexen-1-yl)ethylamino]-3-[4-(6-fluoro-1,2-benzoxazol-3-yl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 58928275 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (2R)-1-[2-(cyclohexen-1-yl)ethylamino]-3-[4-(6-fluoro-1,2-benzoxazol-3-yl)phenoxy]propan-2-ol |
| SMILES | O[C@H](CNCCC1=CCCCC1)COc1ccc(-c2noc3cc(F)ccc23)cc1 |
| InChI | InChI=1S/C24H27FN2O3/c25-19-8-11-22-23(14-19)30-27-24(22)18-6-9-21(10-7-18)29-16-20(28)15-26-13-12-17-4-2-1-3-5-17/h4,6-11,14,20,26,28H,1-3,5,12-13,15-16H2/t20-/m1/s1 |
| InChIKey | AAZRVGLARQZLNR-HXUWFJFHSA-N |
| XLogP | 4.85 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|