C9H20NO2+ — CID 142050616
(2,6-dimethyloxan-3-yl)-hydroxy-dimethylazanium (PubChem CID 142050616) has the molecular formula C9H20NO2+ and a molecular weight of 174.26 g/mol. Its IUPAC name is (2,6-dimethyloxan-3-yl)-hydroxy-dimethylazanium.
| Compound Name | (2,6-dimethyloxan-3-yl)-hydroxy-dimethylazanium |
|---|---|
| PubChem CID | 142050616 |
| Molecular Formula | C9H20NO2+ |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | (2,6-dimethyloxan-3-yl)-hydroxy-dimethylazanium |
| SMILES | CC1CCC([N+](C)(C)O)C(C)O1 |
| InChI | InChI=1S/C9H20NO2/c1-7-5-6-9(8(2)12-7)10(3,4)11/h7-9,11H,5-6H2,1-4H3/q+1 |
| InChIKey | PCMIEBQLLCNTPY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|