C28H24N2O5 — CID 142053405
N-[1-hydroxy-2-(4-hydroxyphenyl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]-2-oxochromene-3-carboxamide (PubChem CID 142053405) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is N-[1-hydroxy-2-(4-hydroxyphenyl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[1-hydroxy-2-(4-hydroxyphenyl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 142053405 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-[1-hydroxy-2-(4-hydroxyphenyl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(c1cc2ccccc2oc1=O)N(CCc1c[nH]c2ccccc12)C(O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C28H24N2O5/c31-21-11-9-18(10-12-21)15-26(32)30(14-13-20-17-29-24-7-3-2-6-22(20)24)27(33)23-16-19-5-1-4-8-25(19)35-28(23)34/h1-12,16-17,26,29,31-32H,13-15H2 |
| InChIKey | FLYKKNUSPVWJNK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|