C14H21N — CID 142053671
8-methyl-3-propyl-4,5,8,9-tetrahydro-3H-1-benzazepine (PubChem CID 142053671) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 8-methyl-3-propyl-4,5,8,9-tetrahydro-3H-1-benzazepine.
| Compound Name | 8-methyl-3-propyl-4,5,8,9-tetrahydro-3H-1-benzazepine |
|---|---|
| PubChem CID | 142053671 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 8-methyl-3-propyl-4,5,8,9-tetrahydro-3H-1-benzazepine |
| SMILES | CCCC1C=NC2=C(C=CC(C)C2)CC1 |
| InChI | InChI=1S/C14H21N/c1-3-4-12-6-8-13-7-5-11(2)9-14(13)15-10-12/h5,7,10-12H,3-4,6,8-9H2,1-2H3 |
| InChIKey | XQIABJNYTYIGFI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |