C10H11N — CID 18435514
5,5a-dihydro-4H-2-benzazepine (PubChem CID 18435514) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 5,5a-dihydro-4H-2-benzazepine.
| Compound Name | 5,5a-dihydro-4H-2-benzazepine |
|---|---|
| PubChem CID | 18435514 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 5,5a-dihydro-4H-2-benzazepine |
| SMILES | C1=CC2=CN=CCCC2C=C1 |
| InChI | InChI=1S/C10H11N/c1-2-5-10-8-11-7-3-6-9(10)4-1/h1-2,4-5,7-9H,3,6H2 |
| InChIKey | QLEWSMVQEKSKCK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |