C26H24N10 — CID 142056712
N-benzyl-1-[4-[3-[[(2Z)-2-(2-iminoethylidene)hydrazinyl]methyl]anilino]-1,3,5-triazin-2-yl]benzimidazol-2-amine (PubChem CID 142056712) has the molecular formula C26H24N10 and a molecular weight of 476.55 g/mol. Its IUPAC name is N-benzyl-1-[4-[3-[[(2Z)-2-(2-iminoethylidene)hydrazinyl]methyl]anilino]-1,3,5-triazin-2-yl]benzimidazol-2-amine.
| Compound Name | N-benzyl-1-[4-[3-[[(2Z)-2-(2-iminoethylidene)hydrazinyl]methyl]anilino]-1,3,5-triazin-2-yl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 142056712 |
| Molecular Formula | C26H24N10 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | N-benzyl-1-[4-[3-[[(2Z)-2-(2-iminoethylidene)hydrazinyl]methyl]anilino]-1,3,5-triazin-2-yl]benzimidazol-2-amine |
| SMILES | [H]/N=C/C=N\NCc1cccc(Nc2ncnc(-n3c(NCc4ccccc4)nc4ccccc43)n2)c1 |
| InChI | InChI=1S/C26H24N10/c27-13-14-31-32-17-20-9-6-10-21(15-20)33-24-29-18-30-26(35-24)36-23-12-5-4-11-22(23)34-25(36)28-16-19-7-2-1-3-8-19/h1-15,18,27,32H,16-17H2,(H,28,34)(H,29,30,33,35)/b27-13+,31-14- |
| InChIKey | YEUPXEYLIYWCEI-UNQKOMHWSA-N |
| XLogP | 4.29 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|