About 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene
4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene (PubChem CID 142058001) has the molecular formula C14H19F
and a molecular weight of 206.30 g/mol. Its IUPAC name is 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene.
Molecular Properties
| Compound Name | 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene |
| PubChem CID | 142058001 |
| Molecular Formula | C14H19F |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene |
| SMILES | CCCc1cc([C@@H]2CC2(C)C)ccc1F |
| InChI | InChI=1S/C14H19F/c1-4-5-11-8-10(6-7-13(11)15)12-9-14(12,2)3/h6-8,12H,4-5,9H2,1-3H3/t12-/m0/s1 |
| InChIKey | IHIRMMGPEPYHJT-LBPRGKRZSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene?
The IUPAC name of 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene (CID 142058001) is 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene.
What is the SMILES notation for 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene?
The canonical SMILES for 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene is CCCc1cc([C@@H]2CC2(C)C)ccc1F.
What is the InChIKey of 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene?
The InChIKey is IHIRMMGPEPYHJT-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H19F/c1-4-5-11-8-10(6-7-13(11)15)12-9-14(12,2)3/h6-8,12H,4-5,9H2,1-3H3/t12-/m0/s1.
What are the key properties of 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene?
4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene has a molecular weight of 206.30 g/mol, XLogP of 4.29, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-propylbenzene is sourced from PubChem (CID 142058001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).