C16H19N3O — CID 142058094
5-[(1R,3R)-3-(2,3-dihydro-1H-inden-4-yl)-2,2-dimethylcyclopropyl]-1,2,4-oxadiazol-3-amine (PubChem CID 142058094) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 5-[(1R,3R)-3-(2,3-dihydro-1H-inden-4-yl)-2,2-dimethylcyclopropyl]-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-[(1R,3R)-3-(2,3-dihydro-1H-inden-4-yl)-2,2-dimethylcyclopropyl]-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 142058094 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 5-[(1R,3R)-3-(2,3-dihydro-1H-inden-4-yl)-2,2-dimethylcyclopropyl]-1,2,4-oxadiazol-3-amine |
| SMILES | CC1(C)[C@H](c2nc(N)no2)[C@H]1c1cccc2c1CCC2 |
| InChI | InChI=1S/C16H19N3O/c1-16(2)12(13(16)14-18-15(17)19-20-14)11-8-4-6-9-5-3-7-10(9)11/h4,6,8,12-13H,3,5,7H2,1-2H3,(H2,17,19)/t12-,13+/m1/s1 |
| InChIKey | ICABVYZEPBHTQV-OLZOCXBDSA-N |
| XLogP | 3.05 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |