C19H27N3O3 — CID 142058475
methyl (2S,4S)-4-[(3-cyanophenyl)methyl-(1-hydroxy-3-methylbutyl)amino]pyrrolidine-2-carboxylate (PubChem CID 142058475) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is methyl (2S,4S)-4-[(3-cyanophenyl)methyl-(1-hydroxy-3-methylbutyl)amino]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-[(3-cyanophenyl)methyl-(1-hydroxy-3-methylbutyl)amino]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 142058475 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | methyl (2S,4S)-4-[(3-cyanophenyl)methyl-(1-hydroxy-3-methylbutyl)amino]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](N(Cc2cccc(C#N)c2)C(O)CC(C)C)CN1 |
| InChI | InChI=1S/C19H27N3O3/c1-13(2)7-18(23)22(12-15-6-4-5-14(8-15)10-20)16-9-17(21-11-16)19(24)25-3/h4-6,8,13,16-18,21,23H,7,9,11-12H2,1-3H3/t16-,17-,18?/m0/s1 |
| InChIKey | DDTQRCZPLOPUSU-UBFHEZILSA-N |
| XLogP | 1.63 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|