C14H16N4O3S — CID 142058599
1-[5-(hydroxymethyl)-2-methylsulfanylpyrimidin-4-yl]-3-(2-methoxyphenyl)urea (PubChem CID 142058599) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-[5-(hydroxymethyl)-2-methylsulfanylpyrimidin-4-yl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[5-(hydroxymethyl)-2-methylsulfanylpyrimidin-4-yl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 142058599 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-[5-(hydroxymethyl)-2-methylsulfanylpyrimidin-4-yl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)Nc1nc(SC)ncc1CO |
| InChI | InChI=1S/C14H16N4O3S/c1-21-11-6-4-3-5-10(11)16-13(20)17-12-9(8-19)7-15-14(18-12)22-2/h3-7,19H,8H2,1-2H3,(H2,15,16,17,18,20) |
| InChIKey | FMLYBWQRSRXXBD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |