C23H35NO3 — CID 142059647
2-methylpropyl (2R)-1-benzyl-5-(3-ethylpentanoyl)pyrrolidine-2-carboxylate (PubChem CID 142059647) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is 2-methylpropyl (2R)-1-benzyl-5-(3-ethylpentanoyl)pyrrolidine-2-carboxylate.
| Compound Name | 2-methylpropyl (2R)-1-benzyl-5-(3-ethylpentanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 142059647 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 2-methylpropyl (2R)-1-benzyl-5-(3-ethylpentanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCC(CC)CC(=O)C1CC[C@H](C(=O)OCC(C)C)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H35NO3/c1-5-18(6-2)14-22(25)20-12-13-21(23(26)27-16-17(3)4)24(20)15-19-10-8-7-9-11-19/h7-11,17-18,20-21H,5-6,12-16H2,1-4H3/t20?,21-/m1/s1 |
| InChIKey | MWBQOYSDHDTIEE-BPGUCPLFSA-N |
| XLogP | 4.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |