C11H23N — CID 142062948
ethane;(2Z)-2-ethylidene-N,3-dimethylpentan-1-imine (PubChem CID 142062948) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is ethane;(2Z)-2-ethylidene-N,3-dimethylpentan-1-imine.
| Compound Name | ethane;(2Z)-2-ethylidene-N,3-dimethylpentan-1-imine |
|---|---|
| PubChem CID | 142062948 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | ethane;(2Z)-2-ethylidene-N,3-dimethylpentan-1-imine |
| SMILES | C/C=C(\C=N\C)C(C)CC.CC |
| InChI | InChI=1S/C9H17N.C2H6/c1-5-8(3)9(6-2)7-10-4;1-2/h6-8H,5H2,1-4H3;1-2H3/b9-6+,10-7+; |
| InChIKey | FSFXXQOJFWLHLO-BHSKDUGMSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|