C14H10FNO5 — CID 142064486
1-(4-fluoro-2,5-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone (PubChem CID 142064486) has the molecular formula C14H10FNO5 and a molecular weight of 291.23 g/mol. Its IUPAC name is 1-(4-fluoro-2,5-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone.
| Compound Name | 1-(4-fluoro-2,5-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 142064486 |
| Molecular Formula | C14H10FNO5 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 1-(4-fluoro-2,5-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)c1cc(O)c(F)cc1O |
| InChI | InChI=1S/C14H10FNO5/c15-11-7-13(18)10(6-14(11)19)12(17)5-8-1-3-9(4-2-8)16(20)21/h1-4,6-7,18-19H,5H2 |
| InChIKey | JHUOMBUQTXKPEL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|