C16H13FO5 — CID 67367377
methyl 4-[2-(5-fluoro-2,4-dihydroxyphenyl)-2-oxoethyl]benzoate (PubChem CID 67367377) has the molecular formula C16H13FO5 and a molecular weight of 304.27 g/mol. Its IUPAC name is methyl 4-[2-(5-fluoro-2,4-dihydroxyphenyl)-2-oxoethyl]benzoate.
| Compound Name | methyl 4-[2-(5-fluoro-2,4-dihydroxyphenyl)-2-oxoethyl]benzoate |
|---|---|
| PubChem CID | 67367377 |
| Molecular Formula | C16H13FO5 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | methyl 4-[2-(5-fluoro-2,4-dihydroxyphenyl)-2-oxoethyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(=O)c2cc(F)c(O)cc2O)cc1 |
| InChI | InChI=1S/C16H13FO5/c1-22-16(21)10-4-2-9(3-5-10)6-13(18)11-7-12(17)15(20)8-14(11)19/h2-5,7-8,19-20H,6H2,1H3 |
| InChIKey | SUANZHPMNDZYNG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |