C16H30N2 — CID 142064525
ethane;N-[(2Z,4E)-3-methylhexa-2,4-dien-2-yl]-1-piperidin-1-ylethanimine (PubChem CID 142064525) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is ethane;N-[(2Z,4E)-3-methylhexa-2,4-dien-2-yl]-1-piperidin-1-ylethanimine.
| Compound Name | ethane;N-[(2Z,4E)-3-methylhexa-2,4-dien-2-yl]-1-piperidin-1-ylethanimine |
|---|---|
| PubChem CID | 142064525 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | ethane;N-[(2Z,4E)-3-methylhexa-2,4-dien-2-yl]-1-piperidin-1-ylethanimine |
| SMILES | C/C=C/C(C)=C(C)\N=C(/C)N1CCCCC1.CC |
| InChI | InChI=1S/C14H24N2.C2H6/c1-5-9-12(2)13(3)15-14(4)16-10-7-6-8-11-16;1-2/h5,9H,6-8,10-11H2,1-4H3;1-2H3/b9-5+,13-12-,15-14+; |
| InChIKey | MQBLTUKOUCZIKV-XGRNRBSESA-N |
| XLogP | 4.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|