C18H32N2O7S — CID 142067161
ethane;formic acid;2-methyl-N-(3,4,5-trimethoxyphenyl)piperidine-1-sulfonamide (PubChem CID 142067161) has the molecular formula C18H32N2O7S and a molecular weight of 420.53 g/mol. Its IUPAC name is ethane;formic acid;2-methyl-N-(3,4,5-trimethoxyphenyl)piperidine-1-sulfonamide.
| Compound Name | ethane;formic acid;2-methyl-N-(3,4,5-trimethoxyphenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 142067161 |
| Molecular Formula | C18H32N2O7S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | ethane;formic acid;2-methyl-N-(3,4,5-trimethoxyphenyl)piperidine-1-sulfonamide |
| SMILES | CC.COc1cc(NS(=O)(=O)N2CCCCC2C)cc(OC)c1OC.O=CO |
| InChI | InChI=1S/C15H24N2O5S.C2H6.CH2O2/c1-11-7-5-6-8-17(11)23(18,19)16-12-9-13(20-2)15(22-4)14(10-12)21-3;1-2;2-1-3/h9-11,16H,5-8H2,1-4H3;1-2H3;1H,(H,2,3) |
| InChIKey | NOLZHYHBMVGNSE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|