C23H38N4O6S — CID 10117716
(2S)-N-(3-piperidin-1-ylpropyl)-1-[(3,4,5-trimethoxyphenyl)sulfamoyl]piperidine-2-carboxamide (PubChem CID 10117716) has the molecular formula C23H38N4O6S and a molecular weight of 498.65 g/mol. Its IUPAC name is (2S)-N-(3-piperidin-1-ylpropyl)-1-[(3,4,5-trimethoxyphenyl)sulfamoyl]piperidine-2-carboxamide.
| Compound Name | (2S)-N-(3-piperidin-1-ylpropyl)-1-[(3,4,5-trimethoxyphenyl)sulfamoyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 10117716 |
| Molecular Formula | C23H38N4O6S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | (2S)-N-(3-piperidin-1-ylpropyl)-1-[(3,4,5-trimethoxyphenyl)sulfamoyl]piperidine-2-carboxamide |
| SMILES | COc1cc(NS(=O)(=O)N2CCCC[C@H]2C(=O)NCCCN2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H38N4O6S/c1-31-20-16-18(17-21(32-2)22(20)33-3)25-34(29,30)27-15-8-5-10-19(27)23(28)24-11-9-14-26-12-6-4-7-13-26/h16-17,19,25H,4-15H2,1-3H3,(H,24,28)/t19-/m0/s1 |
| InChIKey | NUMFOWLBRAVIFL-IBGZPJMESA-N |
| XLogP | 2.22 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|