C25H32N4O5 — CID 142069739
[5-(1-hydroxypentan-2-ylcarbamoyl)-2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]phenyl]-oxidoazanium (PubChem CID 142069739) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is [5-(1-hydroxypentan-2-ylcarbamoyl)-2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]phenyl]-oxidoazanium.
| Compound Name | [5-(1-hydroxypentan-2-ylcarbamoyl)-2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]phenyl]-oxidoazanium |
|---|---|
| PubChem CID | 142069739 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | [5-(1-hydroxypentan-2-ylcarbamoyl)-2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]phenyl]-oxidoazanium |
| SMILES | CCCC(CO)NC(=O)c1ccc(N2CCC(N3C(=O)OCc4ccccc43)CC2)c([NH2+][O-])c1 |
| InChI | InChI=1S/C25H32N4O5/c1-2-5-19(15-30)26-24(31)17-8-9-23(21(14-17)27-33)28-12-10-20(11-13-28)29-22-7-4-3-6-18(22)16-34-25(29)32/h3-4,6-9,14,19-20,30H,2,5,10-13,15-16,27H2,1H3,(H,26,31) |
| InChIKey | IQGCRJXUKCZNJV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|