C24H28N3O5S- — CID 174419009
[2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]-5-(propan-2-ylcarbamoyl)phenyl]methanesulfinate (PubChem CID 174419009) has the molecular formula C24H28N3O5S- and a molecular weight of 470.57 g/mol. Its IUPAC name is [2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]-5-(propan-2-ylcarbamoyl)phenyl]methanesulfinate.
| Compound Name | [2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]-5-(propan-2-ylcarbamoyl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174419009 |
| Molecular Formula | C24H28N3O5S- |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]-5-(propan-2-ylcarbamoyl)phenyl]methanesulfinate |
| SMILES | CC(C)NC(=O)c1ccc(N2CCC(N3C(=O)OCc4ccccc43)CC2)c(CS(=O)[O-])c1 |
| InChI | InChI=1S/C24H29N3O5S/c1-16(2)25-23(28)17-7-8-21(19(13-17)15-33(30)31)26-11-9-20(10-12-26)27-22-6-4-3-5-18(22)14-32-24(27)29/h3-8,13,16,20H,9-12,14-15H2,1-2H3,(H,25,28)(H,30,31)/p-1 |
| InChIKey | FERDNWYLTOKCHT-UHFFFAOYSA-M |
| XLogP | 3.33 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|