C28H37N5O6 — CID 142069755
tert-butyl N-[2-[[3-(methoxyamino)-4-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]benzoyl]amino]ethyl]carbamate (PubChem CID 142069755) has the molecular formula C28H37N5O6 and a molecular weight of 539.63 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(methoxyamino)-4-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]benzoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(methoxyamino)-4-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]benzoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 142069755 |
| Molecular Formula | C28H37N5O6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | tert-butyl N-[2-[[3-(methoxyamino)-4-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]benzoyl]amino]ethyl]carbamate |
| SMILES | CONc1cc(C(=O)NCCNC(=O)OC(C)(C)C)ccc1N1CCC(N2C(=O)OCc3ccccc32)CC1 |
| InChI | InChI=1S/C28H37N5O6/c1-28(2,3)39-26(35)30-14-13-29-25(34)19-9-10-24(22(17-19)31-37-4)32-15-11-21(12-16-32)33-23-8-6-5-7-20(23)18-38-27(33)36/h5-10,17,21,31H,11-16,18H2,1-4H3,(H,29,34)(H,30,35) |
| InChIKey | WHKKBGUUZLZAOT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|