C22H26ClN3O4S — CID 22644580
N-[3-chloro-4-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]phenyl]propane-2-sulfonamide (PubChem CID 22644580) has the molecular formula C22H26ClN3O4S and a molecular weight of 463.99 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]phenyl]propane-2-sulfonamide.
| Compound Name | N-[3-chloro-4-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 22644580 |
| Molecular Formula | C22H26ClN3O4S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | N-[3-chloro-4-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]phenyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1ccc(N2CCC(N3C(=O)OCc4ccccc43)CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H26ClN3O4S/c1-15(2)31(28,29)24-17-7-8-21(19(23)13-17)25-11-9-18(10-12-25)26-20-6-4-3-5-16(20)14-30-22(26)27/h3-8,13,15,18,24H,9-12,14H2,1-2H3 |
| InChIKey | NDXVXJBIZZDGBQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|