C24H30N4O5 — CID 142069756
3-(hydroxyamino)-N-[(2R)-1-hydroxybutan-2-yl]-4-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]benzamide (PubChem CID 142069756) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-(hydroxyamino)-N-[(2R)-1-hydroxybutan-2-yl]-4-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]benzamide.
| Compound Name | 3-(hydroxyamino)-N-[(2R)-1-hydroxybutan-2-yl]-4-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 142069756 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 3-(hydroxyamino)-N-[(2R)-1-hydroxybutan-2-yl]-4-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]benzamide |
| SMILES | CC[C@H](CO)NC(=O)c1ccc(N2CCC(N3C(=O)OCc4ccccc43)CC2)c(NO)c1 |
| InChI | InChI=1S/C24H30N4O5/c1-2-18(14-29)25-23(30)16-7-8-22(20(13-16)26-32)27-11-9-19(10-12-27)28-21-6-4-3-5-17(21)15-33-24(28)31/h3-8,13,18-19,26,29,32H,2,9-12,14-15H2,1H3,(H,25,30)/t18-/m1/s1 |
| InChIKey | CNRMIQFPCWIMHF-GOSISDBHSA-N |
| XLogP | 3.11 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|