C29H33N4O4+ — CID 142069775
hydroxy-[2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]-5-(3-phenylpropylcarbamoyl)phenyl]azanium (PubChem CID 142069775) has the molecular formula C29H33N4O4+ and a molecular weight of 501.61 g/mol. Its IUPAC name is hydroxy-[2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]-5-(3-phenylpropylcarbamoyl)phenyl]azanium.
| Compound Name | hydroxy-[2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]-5-(3-phenylpropylcarbamoyl)phenyl]azanium |
|---|---|
| PubChem CID | 142069775 |
| Molecular Formula | C29H33N4O4+ |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | hydroxy-[2-[4-(2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]-5-(3-phenylpropylcarbamoyl)phenyl]azanium |
| SMILES | O=C(NCCCc1ccccc1)c1ccc(N2CCC(N3C(=O)OCc4ccccc43)CC2)c([NH2+]O)c1 |
| InChI | InChI=1S/C29H32N4O4/c34-28(30-16-6-9-21-7-2-1-3-8-21)22-12-13-27(25(19-22)31-36)32-17-14-24(15-18-32)33-26-11-5-4-10-23(26)20-37-29(33)35/h1-5,7-8,10-13,19,24,31,36H,6,9,14-18,20H2,(H,30,34)/p+1 |
| InChIKey | ILZASZBIWGUTTF-UHFFFAOYSA-O |
| XLogP | 3.76 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|